About 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine
2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine (PubChem CID 126613675) has the molecular formula C27H31N3
and a molecular weight of 397.57 g/mol. Its IUPAC name is 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine.
Molecular Properties
| Compound Name | 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine |
| PubChem CID | 126613675 |
| Molecular Formula | C27H31N3 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine |
| SMILES | CC(C)c1cccc(C(C)C)c1/N=C/Cc1cccc(C/C=N/c2ccccc2)n1 |
| InChI | InChI=1S/C27H31N3/c1-20(2)25-14-9-15-26(21(3)4)27(25)29-19-17-24-13-8-12-23(30-24)16-18-28-22-10-6-5-7-11-22/h5-15,18-21H,16-17H2,1-4H3/b28-18+,29-19+ |
| InChIKey | PXURNDDWTXKGES-UOSOPFLXSA-N |
| XLogP | 7.22 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine?
The IUPAC name of 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine (CID 126613675) is 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine.
What is the SMILES notation for 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine?
The canonical SMILES for 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine is CC(C)c1cccc(C(C)C)c1/N=C/Cc1cccc(C/C=N/c2ccccc2)n1.
What is the InChIKey of 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine?
The InChIKey is PXURNDDWTXKGES-UOSOPFLXSA-N. The full InChI is InChI=1S/C27H31N3/c1-20(2)25-14-9-15-26(21(3)4)27(25)29-19-17-24-13-8-12-23(30-24)16-18-28-22-10-6-5-7-11-22/h5-15,18-21H,16-17H2,1-4H3/b28-18+,29-19+.
What are the key properties of 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine?
2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine has a molecular weight of 397.57 g/mol, XLogP of 7.22, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-[2-[2,6-di(propan-2-yl)phenyl]iminoethyl]-2-pyridinyl]-N-phenylethanimine is sourced from PubChem (CID 126613675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).