C26H17F3N4O — CID 126613677
4,4,4-trifluoro-1-(furan-2-yl)-1-N,3-N-di(quinolin-3-yl)butane-1,3-diimine (PubChem CID 126613677) has the molecular formula C26H17F3N4O and a molecular weight of 458.44 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(furan-2-yl)-1-N,3-N-di(quinolin-3-yl)butane-1,3-diimine.
| Compound Name | 4,4,4-trifluoro-1-(furan-2-yl)-1-N,3-N-di(quinolin-3-yl)butane-1,3-diimine |
|---|---|
| PubChem CID | 126613677 |
| Molecular Formula | C26H17F3N4O |
| Molecular Weight | 458.44 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 4,4,4-trifluoro-1-(furan-2-yl)-1-N,3-N-di(quinolin-3-yl)butane-1,3-diimine |
| SMILES | FC(F)(F)/C(C/C(=N/c1cnc2ccccc2c1)c1ccco1)=N/c1cnc2ccccc2c1 |
| InChI | InChI=1S/C26H17F3N4O/c27-26(28,29)25(33-20-13-18-7-2-4-9-22(18)31-16-20)14-23(24-10-5-11-34-24)32-19-12-17-6-1-3-8-21(17)30-15-19/h1-13,15-16H,14H2/b32-23-,33-25+ |
| InChIKey | CRPYXWOIYIZWCZ-CJKFFMPJSA-N |
| XLogP | 7.22 |
| TPSA | 63.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.44 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|