About (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine
(Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine (PubChem CID 126613742) has the molecular formula C16H32N2
and a molecular weight of 252.45 g/mol. Its IUPAC name is (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine.
Molecular Properties
| Compound Name | (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine |
| PubChem CID | 126613742 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine |
| SMILES | CC(=C(/NC(C)C)C(C)C)/C(=N/C(C)C)C(C)C |
| InChI | InChI=1S/C16H32N2/c1-10(2)15(17-12(5)6)14(9)16(11(3)4)18-13(7)8/h10-13,17H,1-9H3/b15-14-,18-16+ |
| InChIKey | CVBVIDRXQAQQKH-HWWDBJQCSA-N |
| XLogP | 4.42 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine?
The IUPAC name of (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine (CID 126613742) is (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine.
What is the SMILES notation for (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine?
The canonical SMILES for (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine is CC(=C(/NC(C)C)C(C)C)/C(=N/C(C)C)C(C)C.
What is the InChIKey of (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine?
The InChIKey is CVBVIDRXQAQQKH-HWWDBJQCSA-N. The full InChI is InChI=1S/C16H32N2/c1-10(2)15(17-12(5)6)14(9)16(11(3)4)18-13(7)8/h10-13,17H,1-9H3/b15-14-,18-16+.
What are the key properties of (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine?
(Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine has a molecular weight of 252.45 g/mol, XLogP of 4.42, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,4,6-trimethyl-N-propan-2-yl-5-propan-2-yliminohept-3-en-3-amine is sourced from PubChem (CID 126613742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).