About 5-phenylnonan-5-yl dihydrogen phosphite
5-phenylnonan-5-yl dihydrogen phosphite (PubChem CID 126613823) has the molecular formula C15H25O3P
and a molecular weight of 284.34 g/mol. Its IUPAC name is 5-phenylnonan-5-yl dihydrogen phosphite.
Molecular Properties
| Compound Name | 5-phenylnonan-5-yl dihydrogen phosphite |
| PubChem CID | 126613823 |
| Molecular Formula | C15H25O3P |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 5-phenylnonan-5-yl dihydrogen phosphite |
| SMILES | CCCCC(CCCC)(OP(O)O)c1ccccc1 |
| InChI | InChI=1S/C15H25O3P/c1-3-5-12-15(13-6-4-2,18-19(16)17)14-10-8-7-9-11-14/h7-11,16-17H,3-6,12-13H2,1-2H3 |
| InChIKey | JXCAROPNMYOLDF-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylnonan-5-yl dihydrogen phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylnonan-5-yl dihydrogen phosphite?
The IUPAC name of 5-phenylnonan-5-yl dihydrogen phosphite (CID 126613823) is 5-phenylnonan-5-yl dihydrogen phosphite.
What is the SMILES notation for 5-phenylnonan-5-yl dihydrogen phosphite?
The canonical SMILES for 5-phenylnonan-5-yl dihydrogen phosphite is CCCCC(CCCC)(OP(O)O)c1ccccc1.
What is the InChIKey of 5-phenylnonan-5-yl dihydrogen phosphite?
The InChIKey is JXCAROPNMYOLDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25O3P/c1-3-5-12-15(13-6-4-2,18-19(16)17)14-10-8-7-9-11-14/h7-11,16-17H,3-6,12-13H2,1-2H3.
What are the key properties of 5-phenylnonan-5-yl dihydrogen phosphite?
5-phenylnonan-5-yl dihydrogen phosphite has a molecular weight of 284.34 g/mol, XLogP of 4.49, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylnonan-5-yl dihydrogen phosphite is sourced from PubChem (CID 126613823), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).