C24H28FN7O3 — CID 126614014
(1S,2R,5R)-2-[(6-fluoro-3-methoxyquinoxalin-5-yl)methylamino]-5-[(3-methylidene-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)methylamino]cyclohexan-1-ol (PubChem CID 126614014) has the molecular formula C24H28FN7O3 and a molecular weight of 481.53 g/mol. Its IUPAC name is (1S,2R,5R)-2-[(6-fluoro-3-methoxyquinoxalin-5-yl)methylamino]-5-[(3-methylidene-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)methylamino]cyclohexan-1-ol.
| Compound Name | (1S,2R,5R)-2-[(6-fluoro-3-methoxyquinoxalin-5-yl)methylamino]-5-[(3-methylidene-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)methylamino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 126614014 |
| Molecular Formula | C24H28FN7O3 |
| Molecular Weight | 481.53 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (1S,2R,5R)-2-[(6-fluoro-3-methoxyquinoxalin-5-yl)methylamino]-5-[(3-methylidene-4H-pyrazino[2,3-b][1,4]oxazin-6-yl)methylamino]cyclohexan-1-ol |
| SMILES | C=C1COc2ncc(CN[C@@H]3CC[C@@H](NCc4c(F)ccc5ncc(OC)nc45)[C@@H](O)C3)nc2N1 |
| InChI | InChI=1S/C24H28FN7O3/c1-13-12-35-24-23(30-13)31-15(9-29-24)8-26-14-3-5-18(20(33)7-14)27-10-16-17(25)4-6-19-22(16)32-21(34-2)11-28-19/h4,6,9,11,14,18,20,26-27,33H,1,3,5,7-8,10,12H2,2H3,(H,30,31)/t14-,18-,20+/m1/s1 |
| InChIKey | GWZNLLRYHLTCJW-DJKXOVBDSA-N |
| XLogP | 2.05 |
| TPSA | 126.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.53 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |