About 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine
2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine (PubChem CID 126614124) has the molecular formula C16H29N2+
and a molecular weight of 249.42 g/mol. Its IUPAC name is 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine |
| PubChem CID | 126614124 |
| Molecular Formula | C16H29N2+ |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.23 |
| IUPAC Name | 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine |
| SMILES | CC(C)(C)CCC(C)(C)c1cc[n+](CCN)cc1 |
| InChI | InChI=1S/C16H29N2/c1-15(2,3)8-9-16(4,5)14-6-11-18(12-7-14)13-10-17/h6-7,11-12H,8-10,13,17H2,1-5H3/q+1 |
| InChIKey | KOUCBIWGVZLHIN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine?
The IUPAC name of 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine (CID 126614124) is 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine.
What is the SMILES notation for 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine?
The canonical SMILES for 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine is CC(C)(C)CCC(C)(C)c1cc[n+](CCN)cc1.
What is the InChIKey of 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine?
The InChIKey is KOUCBIWGVZLHIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N2/c1-15(2,3)8-9-16(4,5)14-6-11-18(12-7-14)13-10-17/h6-7,11-12H,8-10,13,17H2,1-5H3/q+1.
What are the key properties of 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine?
2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine has a molecular weight of 249.42 g/mol, XLogP of 3.04, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,5,5-trimethylhexan-2-yl)pyridin-1-ium-1-yl]ethanamine is sourced from PubChem (CID 126614124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).