C13H26N2O2 — CID 126615053
N-butyl-1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxamide (PubChem CID 126615053) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is N-butyl-1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxamide.
| Compound Name | N-butyl-1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126615053 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N-butyl-1-hydroxy-2,2,5,5-tetramethylpyrrolidine-3-carboxamide |
| SMILES | CCCCNC(=O)C1CC(C)(C)N(O)C1(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-6-7-8-14-11(16)10-9-12(2,3)15(17)13(10,4)5/h10,17H,6-9H2,1-5H3,(H,14,16) |
| InChIKey | ZQZMSFMSAUNPOB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|