C23H21IN2O2S — CID 126615076
(5E)-2-hydroxy-5-[[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-phenyl-1,3-thiazolidin-4-one (PubChem CID 126615076) has the molecular formula C23H21IN2O2S and a molecular weight of 516.40 g/mol. Its IUPAC name is (5E)-2-hydroxy-5-[[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-phenyl-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-hydroxy-5-[[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-phenyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126615076 |
| Molecular Formula | C23H21IN2O2S |
| Molecular Weight | 516.40 g/mol |
| Exact Mass | 516.04 |
| IUPAC Name | (5E)-2-hydroxy-5-[[1-(4-iodo-3-methylphenyl)-2,5-dimethylpyrrol-3-yl]methylidene]-3-phenyl-1,3-thiazolidin-4-one |
| SMILES | Cc1cc(-n2c(C)cc(/C=C3/SC(O)N(c4ccccc4)C3=O)c2C)ccc1I |
| InChI | InChI=1S/C23H21IN2O2S/c1-14-11-19(9-10-20(14)24)25-15(2)12-17(16(25)3)13-21-22(27)26(23(28)29-21)18-7-5-4-6-8-18/h4-13,23,28H,1-3H3/b21-13+ |
| InChIKey | LEEYMKRFFLUFIJ-FYJGNVAPSA-N |
| XLogP | 5.40 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.40 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|