C12H25N3O2 — CID 126615118
1-hydroxy-2,2,5,5-tetramethyl-N-[2-(methylamino)ethyl]pyrrolidine-3-carboxamide (PubChem CID 126615118) has the molecular formula C12H25N3O2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 1-hydroxy-2,2,5,5-tetramethyl-N-[2-(methylamino)ethyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-hydroxy-2,2,5,5-tetramethyl-N-[2-(methylamino)ethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 126615118 |
| Molecular Formula | C12H25N3O2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.19 |
| IUPAC Name | 1-hydroxy-2,2,5,5-tetramethyl-N-[2-(methylamino)ethyl]pyrrolidine-3-carboxamide |
| SMILES | CNCCNC(=O)C1CC(C)(C)N(O)C1(C)C |
| InChI | InChI=1S/C12H25N3O2/c1-11(2)8-9(12(3,4)15(11)17)10(16)14-7-6-13-5/h9,13,17H,6-8H2,1-5H3,(H,14,16) |
| InChIKey | XTUSQRKZZHLPTF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|