About 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene
15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene (PubChem CID 126615375) has the molecular formula C19H33N
and a molecular weight of 275.48 g/mol. Its IUPAC name is 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene.
Molecular Properties
| Compound Name | 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene |
| PubChem CID | 126615375 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene |
| SMILES | CC1=CN=C(C)C2CCCCCCCCCCCCC12 |
| InChI | InChI=1S/C19H33N/c1-16-15-20-17(2)19-14-12-10-8-6-4-3-5-7-9-11-13-18(16)19/h15,18-19H,3-14H2,1-2H3 |
| InChIKey | RWGFVRUPMWHPMN-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene?
The IUPAC name of 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene (CID 126615375) is 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene.
What is the SMILES notation for 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene?
The canonical SMILES for 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene is CC1=CN=C(C)C2CCCCCCCCCCCCC12.
What is the InChIKey of 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene?
The InChIKey is RWGFVRUPMWHPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H33N/c1-16-15-20-17(2)19-14-12-10-8-6-4-3-5-7-9-11-13-18(16)19/h15,18-19H,3-14H2,1-2H3.
What are the key properties of 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene?
15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene has a molecular weight of 275.48 g/mol, XLogP of 6.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 15,18-dimethyl-16-azabicyclo[12.4.0]octadeca-15,17-diene is sourced from PubChem (CID 126615375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).