C15H9Cl6N3O — CID 126615554
1-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2H-naphthalen-1-ol (PubChem CID 126615554) has the molecular formula C15H9Cl6N3O and a molecular weight of 459.98 g/mol. Its IUPAC name is 1-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2H-naphthalen-1-ol.
| Compound Name | 1-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2H-naphthalen-1-ol |
|---|---|
| PubChem CID | 126615554 |
| Molecular Formula | C15H9Cl6N3O |
| Molecular Weight | 459.98 g/mol |
| Exact Mass | 456.89 |
| IUPAC Name | 1-[4,6-bis(trichloromethyl)-1,3,5-triazin-2-yl]-2H-naphthalen-1-ol |
| SMILES | OC1(c2nc(C(Cl)(Cl)Cl)nc(C(Cl)(Cl)Cl)n2)CC=Cc2ccccc21 |
| InChI | InChI=1S/C15H9Cl6N3O/c16-14(17,18)11-22-10(23-12(24-11)15(19,20)21)13(25)7-3-5-8-4-1-2-6-9(8)13/h1-6,25H,7H2 |
| InChIKey | MPWYQLPDRRCUQK-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 58.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.98 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|