C18H18BrF2N5 — CID 126615635
7-[(3R)-1-[(4-bromo-3,5-difluorophenyl)methyl]piperidin-3-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 126615635) has the molecular formula C18H18BrF2N5 and a molecular weight of 422.28 g/mol. Its IUPAC name is 7-[(3R)-1-[(4-bromo-3,5-difluorophenyl)methyl]piperidin-3-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine.
| Compound Name | 7-[(3R)-1-[(4-bromo-3,5-difluorophenyl)methyl]piperidin-3-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
|---|---|
| PubChem CID | 126615635 |
| Molecular Formula | C18H18BrF2N5 |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 7-[(3R)-1-[(4-bromo-3,5-difluorophenyl)methyl]piperidin-3-yl]-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine |
| SMILES | Cc1cc([C@@H]2CCCN(Cc3cc(F)c(Br)c(F)c3)C2)n2ncnc2n1 |
| InChI | InChI=1S/C18H18BrF2N5/c1-11-5-16(26-18(24-11)22-10-23-26)13-3-2-4-25(9-13)8-12-6-14(20)17(19)15(21)7-12/h5-7,10,13H,2-4,8-9H2,1H3/t13-/m1/s1 |
| InChIKey | GUNBVGWREVTQMM-CYBMUJFWSA-N |
| XLogP | 3.85 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|