C37H33Cl2F3N4O5S — CID 126616151
3-[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonylbenzamide;2,2,2-trifluoroacetic acid (PubChem CID 126616151) has the molecular formula C37H33Cl2F3N4O5S and a molecular weight of 773.66 g/mol. Its IUPAC name is 3-[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonylbenzamide;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonylbenzamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 126616151 |
| Molecular Formula | C37H33Cl2F3N4O5S |
| Molecular Weight | 773.66 g/mol |
| Exact Mass | 772.15 |
| IUPAC Name | 3-[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]sulfonylbenzamide;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)c1cccc(S(=O)(=O)N2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C35H32Cl2N4O3S.C2HF3O2/c36-27-11-6-22(7-12-27)33(23-8-13-28(37)14-9-23)25-10-15-31-32(21-25)41(35(39-31)24-4-5-24)29-16-18-40(19-17-29)45(43,44)30-3-1-2-26(20-30)34(38)42;3-2(4,5)1(6)7/h1-3,6-15,20-21,24,29,33H,4-5,16-19H2,(H2,38,42);(H,6,7) |
| InChIKey | HASITFPOZULEPX-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 135.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.66 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|