C27H26Cl2N2O5 — CID 126616194
methyl 2,2-bis(4-chlorophenyl)-2-[4-nitro-3-(oxan-4-ylmethylamino)phenyl]acetate (PubChem CID 126616194) has the molecular formula C27H26Cl2N2O5 and a molecular weight of 529.42 g/mol. Its IUPAC name is methyl 2,2-bis(4-chlorophenyl)-2-[4-nitro-3-(oxan-4-ylmethylamino)phenyl]acetate.
| Compound Name | methyl 2,2-bis(4-chlorophenyl)-2-[4-nitro-3-(oxan-4-ylmethylamino)phenyl]acetate |
|---|---|
| PubChem CID | 126616194 |
| Molecular Formula | C27H26Cl2N2O5 |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | methyl 2,2-bis(4-chlorophenyl)-2-[4-nitro-3-(oxan-4-ylmethylamino)phenyl]acetate |
| SMILES | COC(=O)C(c1ccc(Cl)cc1)(c1ccc(Cl)cc1)c1ccc([N+](=O)[O-])c(NCC2CCOCC2)c1 |
| InChI | InChI=1S/C27H26Cl2N2O5/c1-35-26(32)27(19-2-7-22(28)8-3-19,20-4-9-23(29)10-5-20)21-6-11-25(31(33)34)24(16-21)30-17-18-12-14-36-15-13-18/h2-11,16,18,30H,12-15,17H2,1H3 |
| InChIKey | KYWXYRJFCMCBBU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|