C36H31Cl3N4 — CID 126616380
3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-chlorobenzonitrile (PubChem CID 126616380) has the molecular formula C36H31Cl3N4 and a molecular weight of 626.03 g/mol. Its IUPAC name is 3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-chlorobenzonitrile.
| Compound Name | 3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-chlorobenzonitrile |
|---|---|
| PubChem CID | 126616380 |
| Molecular Formula | C36H31Cl3N4 |
| Molecular Weight | 626.03 g/mol |
| Exact Mass | 624.16 |
| IUPAC Name | 3-[[4-[6-[bis(4-chlorophenyl)methyl]-2-cyclopropylbenzimidazol-1-yl]piperidin-1-yl]methyl]-2-chlorobenzonitrile |
| SMILES | N#Cc1cccc(CN2CCC(n3c(C4CC4)nc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc43)CC2)c1Cl |
| InChI | InChI=1S/C36H31Cl3N4/c37-29-11-6-23(7-12-29)34(24-8-13-30(38)14-9-24)26-10-15-32-33(20-26)43(36(41-32)25-4-5-25)31-16-18-42(19-17-31)22-28-3-1-2-27(21-40)35(28)39/h1-3,6-15,20,25,31,34H,4-5,16-19,22H2 |
| InChIKey | DKMMSTVRCQZENO-UHFFFAOYSA-N |
| XLogP | 9.76 |
| TPSA | 44.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.03 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|