C26H29N5 — CID 126616661
4-[3-[2-(aminomethyl)-1,3-dihydroinden-2-yl]phenyl]-N-butyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 126616661) has the molecular formula C26H29N5 and a molecular weight of 411.55 g/mol. Its IUPAC name is 4-[3-[2-(aminomethyl)-1,3-dihydroinden-2-yl]phenyl]-N-butyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine.
| Compound Name | 4-[3-[2-(aminomethyl)-1,3-dihydroinden-2-yl]phenyl]-N-butyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 126616661 |
| Molecular Formula | C26H29N5 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 4-[3-[2-(aminomethyl)-1,3-dihydroinden-2-yl]phenyl]-N-butyl-7H-pyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | CCCCNc1nc(-c2cccc(C3(CN)Cc4ccccc4C3)c2)c2cc[nH]c2n1 |
| InChI | InChI=1S/C26H29N5/c1-2-3-12-29-25-30-23(22-11-13-28-24(22)31-25)18-9-6-10-21(14-18)26(17-27)15-19-7-4-5-8-20(19)16-26/h4-11,13-14H,2-3,12,15-17,27H2,1H3,(H2,28,29,30,31) |
| InChIKey | OTTKIQNWUMGIGE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|