C37H33ClF3N3O2 — CID 126616849
3-[[4-[5-[(4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]benzoic acid (PubChem CID 126616849) has the molecular formula C37H33ClF3N3O2 and a molecular weight of 644.14 g/mol. Its IUPAC name is 3-[[4-[5-[(4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-[5-[(4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 126616849 |
| Molecular Formula | C37H33ClF3N3O2 |
| Molecular Weight | 644.14 g/mol |
| Exact Mass | 643.22 |
| IUPAC Name | 3-[[4-[5-[(4-chlorophenyl)-[4-(trifluoromethyl)phenyl]methyl]-1-cyclopropylindazol-3-yl]piperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCC(c3nn(C4CC4)c4ccc(C(c5ccc(Cl)cc5)c5ccc(C(F)(F)F)cc5)cc34)CC2)c1 |
| InChI | InChI=1S/C37H33ClF3N3O2/c38-30-11-6-25(7-12-30)34(24-4-9-29(10-5-24)37(39,40)41)27-8-15-33-32(21-27)35(42-44(33)31-13-14-31)26-16-18-43(19-17-26)22-23-2-1-3-28(20-23)36(45)46/h1-12,15,20-21,26,31,34H,13-14,16-19,22H2,(H,45,46) |
| InChIKey | AIAFYPHMHBHYFP-UHFFFAOYSA-N |
| XLogP | 9.30 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.14 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|