C25H27N5O — CID 126617018
2-(aminomethyl)-N-(2-methoxyethyl)-2-[3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]-1,3-dihydroinden-5-amine (PubChem CID 126617018) has the molecular formula C25H27N5O and a molecular weight of 413.53 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(2-methoxyethyl)-2-[3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]-1,3-dihydroinden-5-amine.
| Compound Name | 2-(aminomethyl)-N-(2-methoxyethyl)-2-[3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]-1,3-dihydroinden-5-amine |
|---|---|
| PubChem CID | 126617018 |
| Molecular Formula | C25H27N5O |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 2-(aminomethyl)-N-(2-methoxyethyl)-2-[3-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)phenyl]-1,3-dihydroinden-5-amine |
| SMILES | COCCNc1ccc2c(c1)CC(CN)(c1cccc(-c3ncnc4[nH]ccc34)c1)C2 |
| InChI | InChI=1S/C25H27N5O/c1-31-10-9-27-21-6-5-18-13-25(15-26,14-19(18)12-21)20-4-2-3-17(11-20)23-22-7-8-28-24(22)30-16-29-23/h2-8,11-12,16,27H,9-10,13-15,26H2,1H3,(H,28,29,30) |
| InChIKey | XNNUDMVHDSAWKS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|