C27H24Cl2F3N3O2S — CID 126617135
5-[bis(4-chlorophenyl)methyl]-3-[1-(2,2,2-trifluoroethylsulfonyl)piperidin-4-yl]-2H-indazole (PubChem CID 126617135) has the molecular formula C27H24Cl2F3N3O2S and a molecular weight of 582.48 g/mol. Its IUPAC name is 5-[bis(4-chlorophenyl)methyl]-3-[1-(2,2,2-trifluoroethylsulfonyl)piperidin-4-yl]-2H-indazole.
| Compound Name | 5-[bis(4-chlorophenyl)methyl]-3-[1-(2,2,2-trifluoroethylsulfonyl)piperidin-4-yl]-2H-indazole |
|---|---|
| PubChem CID | 126617135 |
| Molecular Formula | C27H24Cl2F3N3O2S |
| Molecular Weight | 582.48 g/mol |
| Exact Mass | 581.09 |
| IUPAC Name | 5-[bis(4-chlorophenyl)methyl]-3-[1-(2,2,2-trifluoroethylsulfonyl)piperidin-4-yl]-2H-indazole |
| SMILES | O=S(=O)(CC(F)(F)F)N1CCC(c2[nH]nc3ccc(C(c4ccc(Cl)cc4)c4ccc(Cl)cc4)cc23)CC1 |
| InChI | InChI=1S/C27H24Cl2F3N3O2S/c28-21-6-1-17(2-7-21)25(18-3-8-22(29)9-4-18)20-5-10-24-23(15-20)26(34-33-24)19-11-13-35(14-12-19)38(36,37)16-27(30,31)32/h1-10,15,19,25H,11-14,16H2,(H,33,34) |
| InChIKey | ZTWBZZGRZIWCBO-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.48 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|