C25H25Cl2F3N4O2 — CID 126617470
N-[[4-chloro-3-[4-(4-chloro-3-propan-2-ylphenyl)-6-methoxy-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide (PubChem CID 126617470) has the molecular formula C25H25Cl2F3N4O2 and a molecular weight of 541.40 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-(4-chloro-3-propan-2-ylphenyl)-6-methoxy-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide.
| Compound Name | N-[[4-chloro-3-[4-(4-chloro-3-propan-2-ylphenyl)-6-methoxy-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 126617470 |
| Molecular Formula | C25H25Cl2F3N4O2 |
| Molecular Weight | 541.40 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | N-[[4-chloro-3-[4-(4-chloro-3-propan-2-ylphenyl)-6-methoxy-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
| SMILES | COc1nc(-c2ccc(Cl)c(C(C)C)c2)nc(-c2cc(CNC(=O)C(C)(C)C(F)(F)F)ccc2Cl)n1 |
| InChI | InChI=1S/C25H25Cl2F3N4O2/c1-13(2)16-11-15(7-9-18(16)26)20-32-21(34-23(33-20)36-5)17-10-14(6-8-19(17)27)12-31-22(35)24(3,4)25(28,29)30/h6-11,13H,12H2,1-5H3,(H,31,35) |
| InChIKey | PXSFDPSIBIIPBO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.40 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |