C26H26ClF3N4O2 — CID 126617496
N-[[4-chloro-3-[4-methoxy-6-[3-(1-methylcyclopropyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide (PubChem CID 126617496) has the molecular formula C26H26ClF3N4O2 and a molecular weight of 518.97 g/mol. Its IUPAC name is N-[[4-chloro-3-[4-methoxy-6-[3-(1-methylcyclopropyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide.
| Compound Name | N-[[4-chloro-3-[4-methoxy-6-[3-(1-methylcyclopropyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 126617496 |
| Molecular Formula | C26H26ClF3N4O2 |
| Molecular Weight | 518.97 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | N-[[4-chloro-3-[4-methoxy-6-[3-(1-methylcyclopropyl)phenyl]-1,3,5-triazin-2-yl]phenyl]methyl]-3,3,3-trifluoro-2,2-dimethylpropanamide |
| SMILES | COc1nc(-c2cccc(C3(C)CC3)c2)nc(-c2cc(CNC(=O)C(C)(C)C(F)(F)F)ccc2Cl)n1 |
| InChI | InChI=1S/C26H26ClF3N4O2/c1-24(2,26(28,29)30)22(35)31-14-15-8-9-19(27)18(12-15)21-32-20(33-23(34-21)36-4)16-6-5-7-17(13-16)25(3)10-11-25/h5-9,12-13H,10-11,14H2,1-4H3,(H,31,35) |
| InChIKey | LLAQXFIPGBFIPF-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.97 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |