About 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde
6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde (PubChem CID 126617781) has the molecular formula C11H8N2O2S
and a molecular weight of 232.26 g/mol. Its IUPAC name is 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde.
Molecular Properties
| Compound Name | 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde |
| PubChem CID | 126617781 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde |
| SMILES | COc1ccc2c(c1)nc1sc(C=O)cn12 |
| InChI | InChI=1S/C11H8N2O2S/c1-15-7-2-3-10-9(4-7)12-11-13(10)5-8(6-14)16-11/h2-6H,1H3 |
| InChIKey | FWWMYKAYRJDQBF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde?
The IUPAC name of 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde (CID 126617781) is 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde.
What is the SMILES notation for 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde?
The canonical SMILES for 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde is COc1ccc2c(c1)nc1sc(C=O)cn12.
What is the InChIKey of 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde?
The InChIKey is FWWMYKAYRJDQBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2S/c1-15-7-2-3-10-9(4-7)12-11-13(10)5-8(6-14)16-11/h2-6H,1H3.
What are the key properties of 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde?
6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde has a molecular weight of 232.26 g/mol, XLogP of 2.37, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-[1,3]thiazolo[3,2-a]benzimidazole-2-carbaldehyde is sourced from PubChem (CID 126617781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).