About 1,4-dihydropyrrolo[3,2-c]pyridin-2-one
1,4-dihydropyrrolo[3,2-c]pyridin-2-one (PubChem CID 126618278) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1,4-dihydropyrrolo[3,2-c]pyridin-2-one.
Molecular Properties
| Compound Name | 1,4-dihydropyrrolo[3,2-c]pyridin-2-one |
| PubChem CID | 126618278 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1,4-dihydropyrrolo[3,2-c]pyridin-2-one |
| SMILES | O=C1C=C2CN=CC=C2N1 |
| InChI | InChI=1S/C7H6N2O/c10-7-3-5-4-8-2-1-6(5)9-7/h1-3H,4H2,(H,9,10) |
| InChIKey | XUAZGFRYVQNRCW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dihydropyrrolo[3,2-c]pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dihydropyrrolo[3,2-c]pyridin-2-one?
The IUPAC name of 1,4-dihydropyrrolo[3,2-c]pyridin-2-one (CID 126618278) is 1,4-dihydropyrrolo[3,2-c]pyridin-2-one.
What is the SMILES notation for 1,4-dihydropyrrolo[3,2-c]pyridin-2-one?
The canonical SMILES for 1,4-dihydropyrrolo[3,2-c]pyridin-2-one is O=C1C=C2CN=CC=C2N1.
What is the InChIKey of 1,4-dihydropyrrolo[3,2-c]pyridin-2-one?
The InChIKey is XUAZGFRYVQNRCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c10-7-3-5-4-8-2-1-6(5)9-7/h1-3H,4H2,(H,9,10).
What are the key properties of 1,4-dihydropyrrolo[3,2-c]pyridin-2-one?
1,4-dihydropyrrolo[3,2-c]pyridin-2-one has a molecular weight of 134.14 g/mol, XLogP of 0.01, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dihydropyrrolo[3,2-c]pyridin-2-one is sourced from PubChem (CID 126618278), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).