C12H11BrFN3O3 — CID 126618379
(1R,3S,5R)-3-[(6-bromo-5-fluoro-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexane-2-carboxylic acid (PubChem CID 126618379) has the molecular formula C12H11BrFN3O3 and a molecular weight of 344.14 g/mol. Its IUPAC name is (1R,3S,5R)-3-[(6-bromo-5-fluoro-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexane-2-carboxylic acid.
| Compound Name | (1R,3S,5R)-3-[(6-bromo-5-fluoro-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexane-2-carboxylic acid |
|---|---|
| PubChem CID | 126618379 |
| Molecular Formula | C12H11BrFN3O3 |
| Molecular Weight | 344.14 g/mol |
| Exact Mass | 343.00 |
| IUPAC Name | (1R,3S,5R)-3-[(6-bromo-5-fluoro-2-pyridinyl)carbamoyl]-2-azabicyclo[3.1.0]hexane-2-carboxylic acid |
| SMILES | O=C(Nc1ccc(F)c(Br)n1)[C@@H]1C[C@H]2C[C@H]2N1C(=O)O |
| InChI | InChI=1S/C12H11BrFN3O3/c13-10-6(14)1-2-9(15-10)16-11(18)8-4-5-3-7(5)17(8)12(19)20/h1-2,5,7-8H,3-4H2,(H,19,20)(H,15,16,18)/t5-,7-,8+/m1/s1 |
| InChIKey | JNLNOEKOLIDJBN-NJUXHZRNSA-N |
| XLogP | 2.06 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.14 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|