C11H19NS2 — CID 12661898
4-(diethylamino)-2,2-dimethyl-3H-thiopyran-6-thione (PubChem CID 12661898) has the molecular formula C11H19NS2 and a molecular weight of 229.41 g/mol. Its IUPAC name is 4-(diethylamino)-2,2-dimethyl-3H-thiopyran-6-thione.
| Compound Name | 4-(diethylamino)-2,2-dimethyl-3H-thiopyran-6-thione |
|---|---|
| PubChem CID | 12661898 |
| Molecular Formula | C11H19NS2 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 4-(diethylamino)-2,2-dimethyl-3H-thiopyran-6-thione |
| SMILES | CCN(CC)C1=CC(=S)SC(C)(C)C1 |
| InChI | InChI=1S/C11H19NS2/c1-5-12(6-2)9-7-10(13)14-11(3,4)8-9/h7H,5-6,8H2,1-4H3 |
| InChIKey | XDZPGUMGUMLQPP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|