About 1-fluoro-5,10-dimethylphenazine
1-fluoro-5,10-dimethylphenazine (PubChem CID 126619268) has the molecular formula C14H13FN2
and a molecular weight of 228.27 g/mol. Its IUPAC name is 1-fluoro-5,10-dimethylphenazine.
Molecular Properties
| Compound Name | 1-fluoro-5,10-dimethylphenazine |
| PubChem CID | 126619268 |
| Molecular Formula | C14H13FN2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 1-fluoro-5,10-dimethylphenazine |
| SMILES | CN1c2ccccc2N(C)c2c(F)cccc21 |
| InChI | InChI=1S/C14H13FN2/c1-16-11-7-3-4-8-12(11)17(2)14-10(15)6-5-9-13(14)16/h3-9H,1-2H3 |
| InChIKey | KLNKOQBWTHYDAB-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-fluoro-5,10-dimethylphenazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-fluoro-5,10-dimethylphenazine?
The IUPAC name of 1-fluoro-5,10-dimethylphenazine (CID 126619268) is 1-fluoro-5,10-dimethylphenazine.
What is the SMILES notation for 1-fluoro-5,10-dimethylphenazine?
The canonical SMILES for 1-fluoro-5,10-dimethylphenazine is CN1c2ccccc2N(C)c2c(F)cccc21.
What is the InChIKey of 1-fluoro-5,10-dimethylphenazine?
The InChIKey is KLNKOQBWTHYDAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13FN2/c1-16-11-7-3-4-8-12(11)17(2)14-10(15)6-5-9-13(14)16/h3-9H,1-2H3.
What are the key properties of 1-fluoro-5,10-dimethylphenazine?
1-fluoro-5,10-dimethylphenazine has a molecular weight of 228.27 g/mol, XLogP of 3.67, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-fluoro-5,10-dimethylphenazine is sourced from PubChem (CID 126619268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).