C12H20FN5 — CID 126619321
6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-4-fluoro-4-methyl-1H-pyrimidin-2-amine (PubChem CID 126619321) has the molecular formula C12H20FN5 and a molecular weight of 253.32 g/mol. Its IUPAC name is 6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-4-fluoro-4-methyl-1H-pyrimidin-2-amine.
| Compound Name | 6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-4-fluoro-4-methyl-1H-pyrimidin-2-amine |
|---|---|
| PubChem CID | 126619321 |
| Molecular Formula | C12H20FN5 |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 6-(1,2,3,4,4a,5,7,7a-octahydropyrrolo[3,4-b]pyridin-6-yl)-4-fluoro-4-methyl-1H-pyrimidin-2-amine |
| SMILES | CC1(F)C=C(N2CC3CCCNC3C2)NC(N)=N1 |
| InChI | InChI=1S/C12H20FN5/c1-12(13)5-10(16-11(14)17-12)18-6-8-3-2-4-15-9(8)7-18/h5,8-9,15H,2-4,6-7H2,1H3,(H3,14,16,17) |
| InChIKey | CSJRQFQYGLZFCW-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 65.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|