About [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate
[3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate (PubChem CID 126619522) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate.
Molecular Properties
| Compound Name | [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate |
| PubChem CID | 126619522 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate |
| SMILES | COc1nc(C2=CC(OC(C)=O)CC2)c(C)c2ncccc12 |
| InChI | InChI=1S/C17H18N2O3/c1-10-15(12-6-7-13(9-12)22-11(2)20)19-17(21-3)14-5-4-8-18-16(10)14/h4-5,8-9,13H,6-7H2,1-3H3 |
| InChIKey | BHPIJNOGDKYRNL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate?
The IUPAC name of [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate (CID 126619522) is [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate.
What is the SMILES notation for [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate?
The canonical SMILES for [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate is COc1nc(C2=CC(OC(C)=O)CC2)c(C)c2ncccc12.
What is the InChIKey of [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate?
The InChIKey is BHPIJNOGDKYRNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-10-15(12-6-7-13(9-12)22-11(2)20)19-17(21-3)14-5-4-8-18-16(10)14/h4-5,8-9,13H,6-7H2,1-3H3.
What are the key properties of [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate?
[3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate has a molecular weight of 298.34 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(5-methoxy-8-methyl-1,6-naphthyridin-7-yl)cyclopent-2-en-1-yl] acetate is sourced from PubChem (CID 126619522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).