C26H28N4O — CID 126619594
7-[(3R)-3-[4-(2,3-dihydro-1H-inden-5-yl)piperazin-1-yl]cyclopenten-1-yl]-6H-1,6-naphthyridin-5-one (PubChem CID 126619594) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 7-[(3R)-3-[4-(2,3-dihydro-1H-inden-5-yl)piperazin-1-yl]cyclopenten-1-yl]-6H-1,6-naphthyridin-5-one.
| Compound Name | 7-[(3R)-3-[4-(2,3-dihydro-1H-inden-5-yl)piperazin-1-yl]cyclopenten-1-yl]-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 126619594 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 7-[(3R)-3-[4-(2,3-dihydro-1H-inden-5-yl)piperazin-1-yl]cyclopenten-1-yl]-6H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]c(C2=C[C@H](N3CCN(c4ccc5c(c4)CCC5)CC3)CC2)cc2ncccc12 |
| InChI | InChI=1S/C26H28N4O/c31-26-23-5-2-10-27-25(23)17-24(28-26)20-7-9-22(16-20)30-13-11-29(12-14-30)21-8-6-18-3-1-4-19(18)15-21/h2,5-6,8,10,15-17,22H,1,3-4,7,9,11-14H2,(H,28,31)/t22-/m1/s1 |
| InChIKey | NZARKZGYGRMYLC-JOCHJYFZSA-N |
| XLogP | 3.78 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|