C24H31IN4O4S — CID 126619622
N-[1-[4-hydroxy-2-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl iodide (PubChem CID 126619622) has the molecular formula C24H31IN4O4S and a molecular weight of 598.51 g/mol. Its IUPAC name is N-[1-[4-hydroxy-2-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl iodide.
| Compound Name | N-[1-[4-hydroxy-2-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl iodide |
|---|---|
| PubChem CID | 126619622 |
| Molecular Formula | C24H31IN4O4S |
| Molecular Weight | 598.51 g/mol |
| Exact Mass | 598.11 |
| IUPAC Name | N-[1-[4-hydroxy-2-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl iodide |
| SMILES | Cc1ncsc1-c1ccc(C(C)NC(=O)C2CC(O)CN2C(=O)C(NC(=O)I)C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H31IN4O4S/c1-13(15-6-8-16(9-7-15)19-14(2)26-12-34-19)27-21(31)18-10-17(30)11-29(18)22(32)20(24(3,4)5)28-23(25)33/h6-9,12-13,17-18,20,30H,10-11H2,1-5H3,(H,27,31)(H,28,33) |
| InChIKey | LUXDWWDONGVHTB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|