C23H29IN4O4S — CID 126619626
N-[1-[4-hydroxy-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl iodide (PubChem CID 126619626) has the molecular formula C23H29IN4O4S and a molecular weight of 584.48 g/mol. Its IUPAC name is N-[1-[4-hydroxy-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl iodide.
| Compound Name | N-[1-[4-hydroxy-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl iodide |
|---|---|
| PubChem CID | 126619626 |
| Molecular Formula | C23H29IN4O4S |
| Molecular Weight | 584.48 g/mol |
| Exact Mass | 584.10 |
| IUPAC Name | N-[1-[4-hydroxy-2-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methylcarbamoyl]pyrrolidin-1-yl]-3,3-dimethyl-1-oxobutan-2-yl]carbamoyl iodide |
| SMILES | Cc1ncsc1-c1ccc(CNC(=O)C2CC(O)CN2C(=O)C(NC(=O)I)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H29IN4O4S/c1-13-18(33-12-26-13)15-7-5-14(6-8-15)10-25-20(30)17-9-16(29)11-28(17)21(31)19(23(2,3)4)27-22(24)32/h5-8,12,16-17,19,29H,9-11H2,1-4H3,(H,25,30)(H,27,32) |
| InChIKey | JWUBGUKNFXUSST-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|