C34H26N8O6S2 — CID 126620257
[2-[[5-[5-(1H-indol-4-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl] 2-[[5-[5-(1,2-dimethylindol-5-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethaneperoxoate (PubChem CID 126620257) has the molecular formula C34H26N8O6S2 and a molecular weight of 706.77 g/mol. Its IUPAC name is [2-[[5-[5-(1H-indol-4-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl] 2-[[5-[5-(1,2-dimethylindol-5-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethaneperoxoate.
| Compound Name | [2-[[5-[5-(1H-indol-4-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl] 2-[[5-[5-(1,2-dimethylindol-5-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethaneperoxoate |
|---|---|
| PubChem CID | 126620257 |
| Molecular Formula | C34H26N8O6S2 |
| Molecular Weight | 706.77 g/mol |
| Exact Mass | 706.14 |
| IUPAC Name | [2-[[5-[5-(1H-indol-4-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]acetyl] 2-[[5-[5-(1,2-dimethylindol-5-yl)furan-2-yl]-1H-1,2,4-triazol-3-yl]sulfanyl]ethaneperoxoate |
| SMILES | Cc1cc2cc(-c3ccc(-c4nc(SCC(=O)OOC(=O)CSc5n[nH]c(-c6ccc(-c7cccc8[nH]ccc78)o6)n5)n[nH]4)o3)ccc2n1C |
| InChI | InChI=1S/C34H26N8O6S2/c1-18-14-20-15-19(6-7-24(20)42(18)2)25-8-10-27(45-25)31-36-33(40-38-31)49-16-29(43)47-48-30(44)17-50-34-37-32(39-41-34)28-11-9-26(46-28)22-4-3-5-23-21(22)12-13-35-23/h3-15,35H,16-17H2,1-2H3,(H,36,38,40)(H,37,39,41) |
| InChIKey | IDBZMBTYKTWGCV-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 182.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.77 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|