C30H56N4 — CID 126620901
2,12-diethyl-3,7,8,13,17,18-hexamethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin (PubChem CID 126620901) has the molecular formula C30H56N4 and a molecular weight of 472.81 g/mol. Its IUPAC name is 2,12-diethyl-3,7,8,13,17,18-hexamethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin.
| Compound Name | 2,12-diethyl-3,7,8,13,17,18-hexamethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin |
|---|---|
| PubChem CID | 126620901 |
| Molecular Formula | C30H56N4 |
| Molecular Weight | 472.81 g/mol |
| Exact Mass | 472.45 |
| IUPAC Name | 2,12-diethyl-3,7,8,13,17,18-hexamethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin |
| SMILES | CCC1C2CC3NC(CC4NC(CC5NC(CC(N2)C1C)C(C)C5C)C(CC)C4C)C(C)C3C |
| InChI | InChI=1S/C30H56N4/c1-9-21-19(7)27-11-23-16(4)18(6)26(32-23)14-30-22(10-2)20(8)28(34-30)12-24-15(3)17(5)25(31-24)13-29(21)33-27/h15-34H,9-14H2,1-8H3 |
| InChIKey | HYFDRQQRAVJWTP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.81 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |