C32H60N4 — CID 126620902
2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin (PubChem CID 126620902) has the molecular formula C32H60N4 and a molecular weight of 500.86 g/mol. Its IUPAC name is 2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin.
| Compound Name | 2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin |
|---|---|
| PubChem CID | 126620902 |
| Molecular Formula | C32H60N4 |
| Molecular Weight | 500.86 g/mol |
| Exact Mass | 500.48 |
| IUPAC Name | 2,8,12,18-tetraethyl-3,7,13,17-tetramethyl-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17,18,19,20,21,22,23,24-tetracosahydroporphyrin |
| SMILES | CCC1C2CC3NC(CC4NC(CC5NC(CC(N2)C1C)C(C)C5CC)C(CC)C4C)C(C)C3CC |
| InChI | InChI=1S/C32H60N4/c1-9-21-17(5)25-13-26-19(7)23(11-3)31(35-26)16-32-24(12-4)20(8)28(36-32)14-27-18(6)22(10-2)30(34-27)15-29(21)33-25/h17-36H,9-16H2,1-8H3 |
| InChIKey | PWEQGQRWRJCGBP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.86 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |