C27H30N6O4S — CID 126621047
4-[[4-(5-methoxy-2,3-dihydro-1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]methyl]-1,4-thiazinane 1-oxide (PubChem CID 126621047) has the molecular formula C27H30N6O4S and a molecular weight of 534.64 g/mol. Its IUPAC name is 4-[[4-(5-methoxy-2,3-dihydro-1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]methyl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[[4-(5-methoxy-2,3-dihydro-1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]methyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 126621047 |
| Molecular Formula | C27H30N6O4S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | 4-[[4-(5-methoxy-2,3-dihydro-1H-indol-4-yl)-6-morpholin-4-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-12-yl]methyl]-1,4-thiazinane 1-oxide |
| SMILES | COc1ccc2c(c1-c1nc(N3CCOCC3)c3oc4ncc(CN5CCS(=O)CC5)cc4c3n1)CCN2 |
| InChI | InChI=1S/C27H30N6O4S/c1-35-21-3-2-20-18(4-5-28-20)22(21)25-30-23-19-14-17(16-32-8-12-38(34)13-9-32)15-29-27(19)37-24(23)26(31-25)33-6-10-36-11-7-33/h2-3,14-15,28H,4-13,16H2,1H3 |
| InChIKey | QIVRQQCIHJBQMG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|