C37H45ClF2N4O4 — CID 126622488
(2S,4R)-1-[2-(3-acetyl-6-undec-10-enoxyindazol-1-yl)acetyl]-N-[[3-chloro-2-fluoro-5-[(E)-prop-1-enyl]phenyl]methyl]-4-fluoropyrrolidine-2-carboxamide (PubChem CID 126622488) has the molecular formula C37H45ClF2N4O4 and a molecular weight of 683.24 g/mol. Its IUPAC name is (2S,4R)-1-[2-(3-acetyl-6-undec-10-enoxyindazol-1-yl)acetyl]-N-[[3-chloro-2-fluoro-5-[(E)-prop-1-enyl]phenyl]methyl]-4-fluoropyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[2-(3-acetyl-6-undec-10-enoxyindazol-1-yl)acetyl]-N-[[3-chloro-2-fluoro-5-[(E)-prop-1-enyl]phenyl]methyl]-4-fluoropyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126622488 |
| Molecular Formula | C37H45ClF2N4O4 |
| Molecular Weight | 683.24 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | (2S,4R)-1-[2-(3-acetyl-6-undec-10-enoxyindazol-1-yl)acetyl]-N-[[3-chloro-2-fluoro-5-[(E)-prop-1-enyl]phenyl]methyl]-4-fluoropyrrolidine-2-carboxamide |
| SMILES | C=CCCCCCCCCCOc1ccc2c(C(C)=O)nn(CC(=O)N3C[C@H](F)C[C@H]3C(=O)NCc3cc(/C=C/C)cc(Cl)c3F)c2c1 |
| InChI | InChI=1S/C37H45ClF2N4O4/c1-4-6-7-8-9-10-11-12-13-17-48-29-15-16-30-32(21-29)44(42-36(30)25(3)45)24-34(46)43-23-28(39)20-33(43)37(47)41-22-27-18-26(14-5-2)19-31(38)35(27)40/h4-5,14-16,18-19,21,28,33H,1,6-13,17,20,22-24H2,2-3H3,(H,41,47)/b14-5+/t28-,33+/m1/s1 |
| InChIKey | MGSCQJGPPAUNQB-ICQQBTRQSA-N |
| XLogP | 8.01 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.24 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|