About (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol
(1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol (PubChem CID 126622505) has the molecular formula C12H17FN2O
and a molecular weight of 224.28 g/mol. Its IUPAC name is (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol.
Molecular Properties
| Compound Name | (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol |
| PubChem CID | 126622505 |
| Molecular Formula | C12H17FN2O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol |
| SMILES | Cc1cccc(C[C@H](O)[C@H]2C[C@@H](F)CN2)n1 |
| InChI | InChI=1S/C12H17FN2O/c1-8-3-2-4-10(15-8)6-12(16)11-5-9(13)7-14-11/h2-4,9,11-12,14,16H,5-7H2,1H3/t9-,11-,12+/m1/s1 |
| InChIKey | LIHUEUIEKDZWKK-JLLWLGSASA-N |
| XLogP | 0.99 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol?
The IUPAC name of (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol (CID 126622505) is (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol.
What is the SMILES notation for (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol?
The canonical SMILES for (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol is Cc1cccc(C[C@H](O)[C@H]2C[C@@H](F)CN2)n1.
What is the InChIKey of (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol?
The InChIKey is LIHUEUIEKDZWKK-JLLWLGSASA-N. The full InChI is InChI=1S/C12H17FN2O/c1-8-3-2-4-10(15-8)6-12(16)11-5-9(13)7-14-11/h2-4,9,11-12,14,16H,5-7H2,1H3/t9-,11-,12+/m1/s1.
What are the key properties of (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol?
(1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol has a molecular weight of 224.28 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-[(2R,4R)-4-fluoropyrrolidin-2-yl]-2-(6-methyl-2-pyridinyl)ethanol is sourced from PubChem (CID 126622505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).