About 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid
2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid (PubChem CID 126623099) has the molecular formula C17H13F3N4O4
and a molecular weight of 394.31 g/mol. Its IUPAC name is 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid |
| PubChem CID | 126623099 |
| Molecular Formula | C17H13F3N4O4 |
| Molecular Weight | 394.31 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid |
| SMILES | CC(=O)c1nn(CC(=O)O)c2ccc(-c3cnc(OCC(F)(F)F)nc3)cc12 |
| InChI | InChI=1S/C17H13F3N4O4/c1-9(25)15-12-4-10(2-3-13(12)24(23-15)7-14(26)27)11-5-21-16(22-6-11)28-8-17(18,19)20/h2-6H,7-8H2,1H3,(H,26,27) |
| InChIKey | JVRZHTBWFWTUCG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid?
The IUPAC name of 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid (CID 126623099) is 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid.
What is the SMILES notation for 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid?
The canonical SMILES for 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid is CC(=O)c1nn(CC(=O)O)c2ccc(-c3cnc(OCC(F)(F)F)nc3)cc12.
What is the InChIKey of 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid?
The InChIKey is JVRZHTBWFWTUCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13F3N4O4/c1-9(25)15-12-4-10(2-3-13(12)24(23-15)7-14(26)27)11-5-21-16(22-6-11)28-8-17(18,19)20/h2-6H,7-8H2,1H3,(H,26,27).
What are the key properties of 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid?
2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid has a molecular weight of 394.31 g/mol, XLogP of 2.72, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-acetyl-5-[2-(2,2,2-trifluoroethoxy)pyrimidin-5-yl]indazol-1-yl]acetic acid is sourced from PubChem (CID 126623099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).