About methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate
methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate (PubChem CID 126623194) has the molecular formula C12H14FN3O3
and a molecular weight of 267.26 g/mol. Its IUPAC name is methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate |
| PubChem CID | 126623194 |
| Molecular Formula | C12H14FN3O3 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate |
| SMILES | COC(=O)c1cccc(NC(=O)[C@@H]2C[C@@H](F)CN2)n1 |
| InChI | InChI=1S/C12H14FN3O3/c1-19-12(18)8-3-2-4-10(15-8)16-11(17)9-5-7(13)6-14-9/h2-4,7,9,14H,5-6H2,1H3,(H,15,16,17)/t7-,9+/m1/s1 |
| InChIKey | RKFKZDXBNXUAHX-APPZFPTMSA-N |
| XLogP | 0.51 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate?
The IUPAC name of methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate (CID 126623194) is methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate.
What is the SMILES notation for methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate?
The canonical SMILES for methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate is COC(=O)c1cccc(NC(=O)[C@@H]2C[C@@H](F)CN2)n1.
What is the InChIKey of methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate?
The InChIKey is RKFKZDXBNXUAHX-APPZFPTMSA-N. The full InChI is InChI=1S/C12H14FN3O3/c1-19-12(18)8-3-2-4-10(15-8)16-11(17)9-5-7(13)6-14-9/h2-4,7,9,14H,5-6H2,1H3,(H,15,16,17)/t7-,9+/m1/s1.
What are the key properties of methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate?
methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate has a molecular weight of 267.26 g/mol, XLogP of 0.51, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]pyridine-2-carboxylate is sourced from PubChem (CID 126623194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).