About 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate
2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 126623411) has the molecular formula C19H26FNO5
and a molecular weight of 367.42 g/mol. Its IUPAC name is 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate |
| PubChem CID | 126623411 |
| Molecular Formula | C19H26FNO5 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | COC[C@@]1(F)C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C19H26FNO5/c1-18(2,3)26-17(23)21-12-19(20,13-24-4)10-15(21)16(22)25-11-14-8-6-5-7-9-14/h5-9,15H,10-13H2,1-4H3/t15-,19+/m0/s1 |
| InChIKey | VWPBSMCDEGZIMN-HNAYVOBHSA-N |
| XLogP | 3.09 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate?
The IUPAC name of 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate (CID 126623411) is 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate.
What is the SMILES notation for 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate?
The canonical SMILES for 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate is COC[C@@]1(F)C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OC(C)(C)C)C1.
What is the InChIKey of 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate?
The InChIKey is VWPBSMCDEGZIMN-HNAYVOBHSA-N. The full InChI is InChI=1S/C19H26FNO5/c1-18(2,3)26-17(23)21-12-19(20,13-24-4)10-15(21)16(22)25-11-14-8-6-5-7-9-14/h5-9,15H,10-13H2,1-4H3/t15-,19+/m0/s1.
What are the key properties of 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate?
2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate has a molecular weight of 367.42 g/mol, XLogP of 3.09, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-benzyl 1-O-tert-butyl (2S,4R)-4-fluoro-4-(methoxymethyl)pyrrolidine-1,2-dicarboxylate is sourced from PubChem (CID 126623411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).