C23H24F3N7O3 — CID 126623747
[(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(3R,4R)-4-hydroxy-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone (PubChem CID 126623747) has the molecular formula C23H24F3N7O3 and a molecular weight of 503.49 g/mol. Its IUPAC name is [(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(3R,4R)-4-hydroxy-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone.
| Compound Name | [(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(3R,4R)-4-hydroxy-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone |
|---|---|
| PubChem CID | 126623747 |
| Molecular Formula | C23H24F3N7O3 |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | [(2R,4S)-2-(2,5-difluorophenyl)-4-fluoropyrrolidin-1-yl]-[4-[[(3R,4R)-4-hydroxy-1-(oxetan-3-yl)pyrrolidin-3-yl]amino]-2H-pyrazolo[3,4-d]pyrimidin-3-yl]methanone |
| SMILES | O=C(c1[nH]nc2ncnc(N[C@@H]3CN(C4COC4)C[C@H]3O)c12)N1C[C@@H](F)C[C@@H]1c1cc(F)ccc1F |
| InChI | InChI=1S/C23H24F3N7O3/c24-11-1-2-15(26)14(3-11)17-4-12(25)5-33(17)23(35)20-19-21(27-10-28-22(19)31-30-20)29-16-6-32(7-18(16)34)13-8-36-9-13/h1-3,10,12-13,16-18,34H,4-9H2,(H2,27,28,29,30,31)/t12-,16+,17+,18+/m0/s1 |
| InChIKey | HYZGCMRBXUZWCT-FCRVUTKVSA-N |
| XLogP | 1.41 |
| TPSA | 119.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |