About 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride
6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride (PubChem CID 126623819) has the molecular formula C15H16ClFN2O4S
and a molecular weight of 374.82 g/mol. Its IUPAC name is 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride.
Molecular Properties
| Compound Name | 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride |
| PubChem CID | 126623819 |
| Molecular Formula | C15H16ClFN2O4S |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.05 |
| IUPAC Name | 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc2c(S(=O)(=O)O)cccc2c1)[C@@H]1C[C@@H](F)CN1 |
| InChI | InChI=1S/C15H15FN2O4S.ClH/c16-10-7-13(17-8-10)15(19)18-11-4-5-12-9(6-11)2-1-3-14(12)23(20,21)22;/h1-6,10,13,17H,7-8H2,(H,18,19)(H,20,21,22);1H/t10-,13+;/m1./s1 |
| InChIKey | LLQQWARIPKWGOE-HTKOBJQYSA-N |
| XLogP | 2.15 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride?
The IUPAC name of 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride (CID 126623819) is 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride.
What is the SMILES notation for 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride?
The canonical SMILES for 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride is Cl.O=C(Nc1ccc2c(S(=O)(=O)O)cccc2c1)[C@@H]1C[C@@H](F)CN1.
What is the InChIKey of 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride?
The InChIKey is LLQQWARIPKWGOE-HTKOBJQYSA-N. The full InChI is InChI=1S/C15H15FN2O4S.ClH/c16-10-7-13(17-8-10)15(19)18-11-4-5-12-9(6-11)2-1-3-14(12)23(20,21)22;/h1-6,10,13,17H,7-8H2,(H,18,19)(H,20,21,22);1H/t10-,13+;/m1./s1.
What are the key properties of 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride?
6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride has a molecular weight of 374.82 g/mol, XLogP of 2.15, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[(2S,4R)-4-fluoropyrrolidine-2-carbonyl]amino]naphthalene-1-sulfonic acid;hydrochloride is sourced from PubChem (CID 126623819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).