About [3.5.3]Armilenium
[3.5.3]Armilenium (PubChem CID 12662406) has the molecular formula C11H11+
and a molecular weight of 143.21 g/mol.
Molecular Properties
| Compound Name | [3.5.3]Armilenium |
| PubChem CID | 12662406 |
| Molecular Formula | C11H11+ |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | — |
| SMILES | C1=CC2C3C=CC4C2C4C3[CH+]1 |
| InChI | InChI=1S/C11H11/c1-2-7-6-4-5-9-10(7)11(9)8(6)3-1/h1-11H/q+1 |
| InChIKey | YHLLCJAAILLOIR-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [3.5.3]Armilenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3.5.3]Armilenium?
The IUPAC name of [3.5.3]Armilenium (CID 12662406) is not available.
What is the SMILES notation for [3.5.3]Armilenium?
The canonical SMILES for [3.5.3]Armilenium is C1=CC2C3C=CC4C2C4C3[CH+]1.
What is the InChIKey of [3.5.3]Armilenium?
The InChIKey is YHLLCJAAILLOIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11/c1-2-7-6-4-5-9-10(7)11(9)8(6)3-1/h1-11H/q+1.
What are the key properties of [3.5.3]Armilenium?
[3.5.3]Armilenium has a molecular weight of 143.21 g/mol, XLogP of 2.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [3.5.3]Armilenium is sourced from PubChem (CID 12662406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).