C11H17NO — CID 126624277
(4E,6Z)-2,2,4-trimethyl-7-(methylideneamino)hepta-4,6-dien-3-one (PubChem CID 126624277) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is (4E,6Z)-2,2,4-trimethyl-7-(methylideneamino)hepta-4,6-dien-3-one.
| Compound Name | (4E,6Z)-2,2,4-trimethyl-7-(methylideneamino)hepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 126624277 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | (4E,6Z)-2,2,4-trimethyl-7-(methylideneamino)hepta-4,6-dien-3-one |
| SMILES | C=N/C=C\C=C(/C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H17NO/c1-9(7-6-8-12-5)10(13)11(2,3)4/h6-8H,5H2,1-4H3/b8-6-,9-7+ |
| InChIKey | MRTDCOFPPIVUQJ-MKKAVFGOSA-N |
| XLogP | 2.76 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|