C82H56F6N4O2 — CID 126624356
7,7-dipropyl-5-pyridin-4-yl-2,9-bis[3-[3-[3-(1,2,2-trifluoroethenoxy)phenyl]carbazol-9-yl]phenyl]indeno[2,1-b]carbazole (PubChem CID 126624356) has the molecular formula C82H56F6N4O2 and a molecular weight of 1243.36 g/mol. Its IUPAC name is 7,7-dipropyl-5-pyridin-4-yl-2,9-bis[3-[3-[3-(1,2,2-trifluoroethenoxy)phenyl]carbazol-9-yl]phenyl]indeno[2,1-b]carbazole.
| Compound Name | 7,7-dipropyl-5-pyridin-4-yl-2,9-bis[3-[3-[3-(1,2,2-trifluoroethenoxy)phenyl]carbazol-9-yl]phenyl]indeno[2,1-b]carbazole |
|---|---|
| PubChem CID | 126624356 |
| Molecular Formula | C82H56F6N4O2 |
| Molecular Weight | 1243.36 g/mol |
| Exact Mass | 1242.43 |
| IUPAC Name | 7,7-dipropyl-5-pyridin-4-yl-2,9-bis[3-[3-[3-(1,2,2-trifluoroethenoxy)phenyl]carbazol-9-yl]phenyl]indeno[2,1-b]carbazole |
| SMILES | CCCC1(CCC)c2cc(-c3cccc(-n4c5ccccc5c5cc(-c6cccc(OC(F)=C(F)F)c6)ccc54)c3)ccc2-c2cc3c4cc(-c5cccc(-n6c7ccccc7c7cc(-c8cccc(OC(F)=C(F)F)c8)ccc76)c5)ccc4n(-c4ccncc4)c3cc21 |
| InChI | InChI=1S/C82H56F6N4O2/c1-3-35-82(36-4-2)70-46-56(50-14-10-18-59(40-50)92-73-24-8-6-22-64(73)67-44-55(28-31-75(67)92)52-16-12-20-61(42-52)94-81(88)79(85)86)25-29-62(70)65-47-69-68-45-53(26-32-76(68)90(77(69)48-71(65)82)57-33-37-89-38-34-57)49-13-9-17-58(39-49)91-72-23-7-5-21-63(72)66-43-54(27-30-74(66)91)51-15-11-19-60(41-51)93-80(87)78(83)84/h5-34,37-48H,3-4,35-36H2,1-2H3 |
| InChIKey | MQSIZGAGCHFUEB-UHFFFAOYSA-N |
| XLogP | 23.74 |
| TPSA | 46.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 94 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1243.36 |
| LogP ≤ 5 | 23.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|