C24H19N3O4 — CID 126624635
4,11-diamino-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]naphtho[2,3-f]isoindole-1,3,5,10-tetrone (PubChem CID 126624635) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is 4,11-diamino-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]naphtho[2,3-f]isoindole-1,3,5,10-tetrone.
| Compound Name | 4,11-diamino-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]naphtho[2,3-f]isoindole-1,3,5,10-tetrone |
|---|---|
| PubChem CID | 126624635 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 4,11-diamino-2-[(2Z,4E,6Z)-octa-2,4,6-trien-4-yl]naphtho[2,3-f]isoindole-1,3,5,10-tetrone |
| SMILES | C/C=C\C=C(/C=C\C)n1c(=O)c2c(N)c3c(=O)c4ccccc4c(=O)c3c(N)c2c1=O |
| InChI | InChI=1S/C24H19N3O4/c1-3-5-9-12(8-4-2)27-23(30)17-18(24(27)31)20(26)16-15(19(17)25)21(28)13-10-6-7-11-14(13)22(16)29/h3-11H,25-26H2,1-2H3/b5-3-,8-4-,12-9+ |
| InChIKey | QOLDJFKZMMNNMF-UWXHFTNLSA-N |
| XLogP | 2.42 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|