C14H17F5O2S — CID 126625173
1,2,3,4,5-pentafluoro-6-octan-4-ylsulfonylbenzene (PubChem CID 126625173) has the molecular formula C14H17F5O2S and a molecular weight of 344.35 g/mol. Its IUPAC name is 1,2,3,4,5-pentafluoro-6-octan-4-ylsulfonylbenzene.
| Compound Name | 1,2,3,4,5-pentafluoro-6-octan-4-ylsulfonylbenzene |
|---|---|
| PubChem CID | 126625173 |
| Molecular Formula | C14H17F5O2S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 1,2,3,4,5-pentafluoro-6-octan-4-ylsulfonylbenzene |
| SMILES | CCCCC(CCC)S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H17F5O2S/c1-3-5-7-8(6-4-2)22(20,21)14-12(18)10(16)9(15)11(17)13(14)19/h8H,3-7H2,1-2H3 |
| InChIKey | VAFXBUCBUHTQMD-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|