C21H36N2 — CID 126625706
1-N,1-N'-dimethyl-1-N-(4-methylcyclohexa-1,5-dien-1-yl)-1-N'-(2,5,5-trimethyl-3-methylidenehexan-2-yl)ethene-1,1-diamine (PubChem CID 126625706) has the molecular formula C21H36N2 and a molecular weight of 316.53 g/mol. Its IUPAC name is 1-N,1-N'-dimethyl-1-N-(4-methylcyclohexa-1,5-dien-1-yl)-1-N'-(2,5,5-trimethyl-3-methylidenehexan-2-yl)ethene-1,1-diamine.
| Compound Name | 1-N,1-N'-dimethyl-1-N-(4-methylcyclohexa-1,5-dien-1-yl)-1-N'-(2,5,5-trimethyl-3-methylidenehexan-2-yl)ethene-1,1-diamine |
|---|---|
| PubChem CID | 126625706 |
| Molecular Formula | C21H36N2 |
| Molecular Weight | 316.53 g/mol |
| Exact Mass | 316.29 |
| IUPAC Name | 1-N,1-N'-dimethyl-1-N-(4-methylcyclohexa-1,5-dien-1-yl)-1-N'-(2,5,5-trimethyl-3-methylidenehexan-2-yl)ethene-1,1-diamine |
| SMILES | C=C(N(C)C1=CCC(C)C=C1)N(C)C(C)(C)C(=C)CC(C)(C)C |
| InChI | InChI=1S/C21H36N2/c1-16-11-13-19(14-12-16)22(9)18(3)23(10)21(7,8)17(2)15-20(4,5)6/h11,13-14,16H,2-3,12,15H2,1,4-10H3 |
| InChIKey | ARJYLMCIJWAGLW-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|