C21H20ClF2N5 — CID 126625726
2-[(4-chlorophenyl)methyl]-1-cyclobutyl-3-[5-(3,5-difluorophenyl)-1H-pyrazol-3-yl]guanidine (PubChem CID 126625726) has the molecular formula C21H20ClF2N5 and a molecular weight of 415.88 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-1-cyclobutyl-3-[5-(3,5-difluorophenyl)-1H-pyrazol-3-yl]guanidine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-1-cyclobutyl-3-[5-(3,5-difluorophenyl)-1H-pyrazol-3-yl]guanidine |
|---|---|
| PubChem CID | 126625726 |
| Molecular Formula | C21H20ClF2N5 |
| Molecular Weight | 415.88 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-1-cyclobutyl-3-[5-(3,5-difluorophenyl)-1H-pyrazol-3-yl]guanidine |
| SMILES | Fc1cc(F)cc(-c2cc(N/C(=N/Cc3ccc(Cl)cc3)NC3CCC3)n[nH]2)c1 |
| InChI | InChI=1S/C21H20ClF2N5/c22-15-6-4-13(5-7-15)12-25-21(26-18-2-1-3-18)27-20-11-19(28-29-20)14-8-16(23)10-17(24)9-14/h4-11,18H,1-3,12H2,(H3,25,26,27,28,29) |
| InChIKey | UCQNEDONQDSGIO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.88 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|