About 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole
1-(3-fluorobuta-1,3-dien-2-yl)pyrazole (PubChem CID 126625893) has the molecular formula C7H7FN2
and a molecular weight of 138.14 g/mol. Its IUPAC name is 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole.
Molecular Properties
| Compound Name | 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole |
| PubChem CID | 126625893 |
| Molecular Formula | C7H7FN2 |
| Molecular Weight | 138.14 g/mol |
| Exact Mass | 138.06 |
| IUPAC Name | 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole |
| SMILES | C=C(F)C(=C)n1cccn1 |
| InChI | InChI=1S/C7H7FN2/c1-6(8)7(2)10-5-3-4-9-10/h3-5H,1-2H2 |
| InChIKey | WBUXDJPAQHQZOB-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.14 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole?
The IUPAC name of 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole (CID 126625893) is 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole.
What is the SMILES notation for 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole?
The canonical SMILES for 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole is C=C(F)C(=C)n1cccn1.
What is the InChIKey of 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole?
The InChIKey is WBUXDJPAQHQZOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN2/c1-6(8)7(2)10-5-3-4-9-10/h3-5H,1-2H2.
What are the key properties of 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole?
1-(3-fluorobuta-1,3-dien-2-yl)pyrazole has a molecular weight of 138.14 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluorobuta-1,3-dien-2-yl)pyrazole is sourced from PubChem (CID 126625893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).